CAS 886366-59-2

1-(2-nitrophenyl)cyclopropanamine

Description:

1-(2-Nitrophenyl)cyclopropanamine is an organic compound characterized by its cyclopropane structure fused with a nitrophenyl group. The presence of the nitro group (-NO2) on the phenyl ring significantly influences its chemical properties, including its reactivity and polarity. This compound typically exhibits a pale yellow to light brown appearance and is soluble in organic solvents. It may participate in various chemical reactions, such as nucleophilic substitutions and reductions, due to the electron-withdrawing nature of the nitro group. Additionally, the cyclopropane moiety can introduce unique strain-related reactivity, making it a subject of interest in synthetic organic chemistry. The compound's potential applications may extend to pharmaceuticals and agrochemicals, where the cyclopropanamine framework can serve as a building block for more complex molecules. Safety considerations should be taken into account, as nitro compounds can be hazardous and may require careful handling and storage.

Formula: C₉H₁₀N₂O₂

InChI: InChI=1/C9H10N2O2/c10-9(5-6-9)7-3-1-2-4-8(7)11(12)13/h1-4H,5-6,10H2

Synonyms:

• 1-(2-Nitrophenyl)cyclopropanamin