CAS 886366-73-0

2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-amine hydrochloride

Description:

2,3,4,5-tetrahydro-1H-1,4-benzodiazepin-8-amine hydrochloride is a chemical compound that belongs to the benzodiazepine class, which is known for its psychoactive properties. This substance features a bicyclic structure that includes a benzene ring fused to a diazepine ring, contributing to its pharmacological activity. The presence of the amine group at the 8-position enhances its potential for interaction with biological targets, particularly in the central nervous system. As a hydrochloride salt, it is typically more soluble in water, facilitating its use in various formulations. The compound may exhibit anxiolytic, sedative, or anticonvulsant effects, similar to other benzodiazepines, although specific pharmacological profiles can vary. Safety and efficacy profiles are determined through rigorous testing, and its use would be subject to regulatory oversight. As with many compounds in this class, potential side effects and interactions with other medications should be carefully considered in clinical settings.

Formula: C₉H₁₄ClN₃

InChI: InChI=1/C9H13N3.ClH/c10-8-2-1-7-6-11-3-4-12-9(7)5-8;/h1-2,5,11-12H,3-4,6,10H2;1H

SMILES: c1cc(cc2c1CNCCN2)N.Cl

2,3,4,5-Tetrahydro-1H-benzo[e][1,4]diazepin-8-amine

CAS: 886366-73-0

Formula: C₉H₁₃N₃

Molecular weight: 163.2196

Ref: IN-DA004AEN