CAS 886366-77-4

1,2,3,4-Tetrahydro-9-methyl-5H-1-benzazepin-5-one

Description:

1,2,3,4-Tetrahydro-9-methyl-5H-1-benzazepin-5-one is a bicyclic compound characterized by its unique structure, which includes a benzene ring fused to a seven-membered nitrogen-containing ring. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The methyl group at the 9-position enhances its lipophilicity, potentially influencing its biological activity and interaction with various receptors. As a member of the benzazepine family, it may exhibit pharmacological properties, making it of interest in medicinal chemistry. The presence of a carbonyl group (ketone) at the 5-position is significant for its reactivity and potential for further chemical modifications. The compound's CAS number, 886366-77-4, allows for precise identification in chemical databases, facilitating research and development in various applications, including drug discovery and synthesis. Overall, this compound's structural features suggest potential utility in therapeutic contexts, although specific biological activities would require further investigation.

Formula: C₁₁H₁₃NO

InChI: InChI=1S/C11H13NO/c1-8-4-2-5-9-10(13)6-3-7-12-11(8)9/h2,4-5,12H,3,6-7H2,1H3

InChI key: InChIKey=DMHKLCWBDQXJIU-UHFFFAOYSA-N

SMILES: O=C1C=2C(=C(C)C=CC2)NCCC1

Synonyms:

• 1,2,3,4-Tetrahydro-9-methyl-5H-1-benzazepin-5-one
• 5H-1-Benzazepin-5-one, 1,2,3,4-tetrahydro-9-methyl-