CAS 886367-64-2
:2-Bromo-4-(2-methoxy-4-methylphenyl)thiazole
Description:
2-Bromo-4-(2-methoxy-4-methylphenyl)thiazole is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing both sulfur and nitrogen. The presence of a bromine atom at the 2-position and a methoxy group attached to a methyl-substituted phenyl group at the 4-position contributes to its unique chemical properties. This compound is likely to exhibit moderate to high lipophilicity due to the aromatic and aliphatic groups, which can influence its solubility in organic solvents. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry for developing pharmaceuticals. The compound may also participate in various chemical reactions typical of halogenated compounds, such as nucleophilic substitutions. Its specific reactivity and applications would depend on the functional groups present and the overall molecular structure, making it of interest in both synthetic organic chemistry and potential therapeutic applications.
Formula:C11H10BrNOS
InChI:InChI=1S/C11H10BrNOS/c1-7-3-4-8(10(5-7)14-2)9-6-15-11(12)13-9/h3-6H,1-2H3
InChI key:InChIKey=HQHUMXBLUKXRFE-UHFFFAOYSA-N
SMILES:O(C)C1=C(C=CC(C)=C1)C=2N=C(Br)SC2
Synonyms:- Thiazole, 2-bromo-4-(2-methoxy-4-methylphenyl)-
- 2-Bromo-4-(2-methoxy-4-methylphenyl)thiazole
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
