CAS 886367-79-9
:2-Bromo-4-(3-chlorophenyl)-1,3-thiazole
Description:
2-Bromo-4-(3-chlorophenyl)-1,3-thiazole is a heterocyclic organic compound characterized by the presence of a thiazole ring, which is a five-membered ring containing both sulfur and nitrogen atoms. The compound features a bromine atom and a chlorophenyl group, contributing to its unique chemical properties. The thiazole moiety is known for its biological activity, often serving as a scaffold in medicinal chemistry. This compound may exhibit various physical properties such as solubility in organic solvents and potential reactivity due to the presence of halogen substituents, which can influence its interactions in chemical reactions. Additionally, the presence of the bromine and chlorine atoms can enhance its lipophilicity and may affect its pharmacokinetic properties if considered for pharmaceutical applications. Overall, 2-Bromo-4-(3-chlorophenyl)-1,3-thiazole is of interest in research contexts, particularly in the development of new therapeutic agents or as a building block in organic synthesis.
Formula:C9H5BrClNS
InChI:InChI=1/C9H5BrClNS/c10-9-12-8(5-13-9)6-2-1-3-7(11)4-6/h1-5H
SMILES:c1cc(cc(c1)Cl)c1csc(Br)n1
Synonyms:- Thiazole, 2-Bromo-4-(3-Chlorophenyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
