CAS 886367-92-6
:2-(4-phenylpyrimidin-2-yl)ethanamine
Description:
2-(4-phenylpyrimidin-2-yl)ethanamine, with the CAS number 886367-92-6, is an organic compound characterized by its structure, which features a pyrimidine ring substituted with a phenyl group and an ethanamine moiety. This compound typically exhibits properties associated with both aromatic and aliphatic systems, including potential solubility in organic solvents and moderate polarity. The presence of the amine group suggests that it may engage in hydrogen bonding, influencing its reactivity and interactions with other molecules. Additionally, the pyrimidine ring contributes to its potential biological activity, as many pyrimidine derivatives are known for their roles in pharmaceuticals and as bioactive compounds. The compound's molecular structure may allow it to participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. Overall, 2-(4-phenylpyrimidin-2-yl)ethanamine is of interest in medicinal chemistry and could be explored for its potential therapeutic applications.
Formula:C12H13N3
InChI:InChI=1/C12H13N3/c13-8-6-12-14-9-7-11(15-12)10-4-2-1-3-5-10/h1-5,7,9H,6,8,13H2
SMILES:c1ccc(cc1)c1ccnc(CCN)n1
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.
2-(4-Phenylpyrimidin-2-yl)ethanamine
CAS:2-(4-Phenylpyrimidin-2-yl)ethanamine
Molecular weight:199.25g/mol

