CAS 886368-25-8

Ethyl 2-(4-bromo-2-methylphenyl)-1,3-thiazole-4-carboxylate

Description:

Ethyl 2-(4-bromo-2-methylphenyl)-1,3-thiazole-4-carboxylate is a chemical compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. The presence of the ethyl ester functional group contributes to its solubility in organic solvents, making it useful in various chemical reactions. The compound features a bromo substituent on the aromatic ring, which can enhance its reactivity and influence its biological activity. The methyl group on the phenyl ring adds steric bulk, potentially affecting the compound's interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its molecular structure suggests potential applications in the development of agrochemicals or pharmaceuticals, particularly in the synthesis of more complex molecules. As with many thiazole derivatives, it may also possess antimicrobial or antifungal properties, warranting investigation into its biological efficacy.

Formula: C₁₃H₁₂BrNO₂S

InChI: InChI=1/C13H12BrNO2S/c1-3-17-13(16)11-7-18-12(15-11)10-5-4-9(14)6-8(10)2/h4-7H,3H2,1-2H3

SMILES: CCOC(=O)c1csc(c2ccc(cc2C)Br)n1

Ethyl 2-(4-bromo-2-methylphenyl)thiazole-4-carboxylate

CAS: 886368-25-8

Formula: C₁₃H₁₂BrNO₂S

Molecular weight: 326.2089

Ref: IN-DA00GS5U