CymitQuimica logo

CAS 886368-70-3

:

2,4-Dimethoxy-α-(trifluoromethyl)benzenemethanamine

Description:
2,4-Dimethoxy-α-(trifluoromethyl)benzenemethanamine, with the CAS number 886368-70-3, is a chemical compound characterized by its unique molecular structure, which includes a benzene ring substituted with two methoxy groups and a trifluoromethyl group. This compound is part of the class of aromatic amines, which are known for their potential applications in pharmaceuticals and agrochemicals. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its biological activity, making it a subject of interest in medicinal chemistry. The methoxy groups contribute to the compound's electronic properties, potentially affecting its reactivity and interaction with biological targets. Additionally, the amine functional group can participate in hydrogen bonding, which may play a role in its solubility and interaction with other molecules. Overall, 2,4-Dimethoxy-α-(trifluoromethyl)benzenemethanamine exhibits a combination of structural features that may confer specific chemical and biological properties, warranting further investigation for potential applications.
Formula:C10H12F3NO2
InChI:InChI=1S/C10H12F3NO2/c1-15-6-3-4-7(8(5-6)16-2)9(14)10(11,12)13/h3-5,9H,14H2,1-2H3
InChI key:InChIKey=MJZVNVRMFKNDNI-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(OC)C=C(OC)C=C1
Synonyms:
  • 2,4-Dimethoxy-α-(trifluoromethyl)benzenemethanamine
  • Benzenemethanamine, 2,4-dimethoxy-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.