CymitQuimica logo

CAS 886369-16-0

:

4-(1-Methylethyl)-α-(trifluoromethyl)benzenemethanamine

Description:
4-(1-Methylethyl)-α-(trifluoromethyl)benzenemethanamine, also known by its CAS number 886369-16-0, is an organic compound characterized by its complex structure featuring a trifluoromethyl group and an isopropyl substituent on a benzene ring. This compound typically exhibits properties associated with aromatic amines, including potential solubility in organic solvents and moderate reactivity due to the presence of the amine functional group. The trifluoromethyl group is known to enhance the lipophilicity and metabolic stability of the molecule, which can influence its biological activity and interactions. Additionally, the presence of the isopropyl group may affect steric hindrance and electronic properties, potentially impacting its reactivity and binding affinity in various chemical contexts. As with many organic compounds, safety and handling precautions are essential, particularly due to the potential toxicity associated with amines and fluorinated compounds. Overall, this substance may have applications in pharmaceuticals, agrochemicals, or materials science, depending on its specific properties and reactivity.
Formula:C11H14F3N
InChI:InChI=1S/C11H14F3N/c1-7(2)8-3-5-9(6-4-8)10(15)11(12,13)14/h3-7,10H,15H2,1-2H3
InChI key:InChIKey=VVGBANCFPOXXPY-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=CC=C(C(C)C)C=C1
Synonyms:
  • Benzenemethanamine, 4-(1-methylethyl)-α-(trifluoromethyl)-
  • 4-(1-Methylethyl)-α-(trifluoromethyl)benzenemethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.