CAS 886369-21-7

4-(1,1-Dimethylethyl)-α-(trifluoromethyl)benzenemethanamine

Description:

4-(1,1-Dimethylethyl)-α-(trifluoromethyl)benzenemethanamine, with the CAS number 886369-21-7, is an organic compound characterized by its unique structural features. It contains a benzene ring substituted with a trifluoromethyl group and a tert-butyl group, which significantly influence its chemical properties. The presence of the trifluoromethyl group enhances the compound's lipophilicity and can affect its reactivity and interaction with biological systems. The amine functional group contributes to its potential as a base and nucleophile, allowing for various chemical reactions, including alkylation and acylation. This compound may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its molecular structure suggests potential applications in agrochemicals or pharmaceuticals, where the combination of hydrophobic and hydrophilic characteristics can be advantageous. Additionally, the presence of fluorine atoms often imparts unique electronic properties, which can influence the compound's stability and reactivity. Overall, this compound's distinctive features make it a subject of interest for further research and application in various chemical fields.

Formula: C₁₂H₁₆F₃N

InChI: InChI=1S/C12H16F3N/c1-11(2,3)9-6-4-8(5-7-9)10(16)12(13,14)15/h4-7,10H,16H2,1-3H3

InChI key: InChIKey=WBVVOROITVUGEO-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(N)C1=CC=C(C(C)(C)C)C=C1

Synonyms:

• Benzenemethanamine, 4-(1,1-dimethylethyl)-α-(trifluoromethyl)-
• 4-(1,1-Dimethylethyl)-α-(trifluoromethyl)benzenemethanamine