CAS 886369-30-8
:5-Thiazolecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester
Description:
5-Thiazolecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester is an organic compound characterized by its thiazole ring, which is a five-membered heterocyclic structure containing sulfur and nitrogen. This compound features a carboxylic acid functional group, which is esterified with an ethyl group, enhancing its solubility and reactivity. The presence of the 4-chlorophenyl group introduces a chlorinated aromatic moiety, which can influence the compound's biological activity and lipophilicity. Typically, compounds of this nature may exhibit various pharmacological properties, making them of interest in medicinal chemistry. The thiazole ring is known for its role in various biological activities, including antimicrobial and anti-inflammatory effects. Additionally, the compound's structure suggests potential applications in agrochemicals or pharmaceuticals, where the thiazole and aromatic functionalities can contribute to the overall efficacy and selectivity of the compound. As with many organic compounds, the specific characteristics, such as melting point, boiling point, and solubility, would depend on the molecular interactions and the environment in which the compound is studied.
Formula:C12H10ClNO2S
InChI:InChI=1S/C12H10ClNO2S/c1-2-16-12(15)10-7-14-11(17-10)8-3-5-9(13)6-4-8/h3-7H,2H2,1H3
InChI key:InChIKey=MSUPOBBAHYDCLP-UHFFFAOYSA-N
SMILES:C(OCC)(=O)C=1SC(=NC1)C2=CC=C(Cl)C=C2
Synonyms:- 5-Thiazolecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester
- 2-(4-Chloro-phenyl)-thiazole-5-carboxylic acid ethyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
5-Thiazolecarboxylic acid, 2-(4-chlorophenyl)-, ethyl ester
CAS:Formula:C12H10ClNO2SMolecular weight:267.7313
