CymitQuimica logo

CAS 886369-68-2

:

2,2,2-trifluoro-1-(3,4,5-trifluorophenyl)ethanone

Description:
2,2,2-Trifluoro-1-(3,4,5-trifluorophenyl)ethanone, with the CAS number 886369-68-2, is a fluorinated organic compound characterized by its unique structure that includes a trifluoroethyl group and a trifluorophenyl moiety. This compound is typically a colorless to pale yellow liquid or solid, depending on its physical state at room temperature. The presence of multiple fluorine atoms contributes to its high electronegativity, making it highly polar and potentially increasing its reactivity compared to non-fluorinated analogs. It exhibits significant thermal stability and is resistant to oxidation, which can be advantageous in various chemical applications. The trifluoromethyl groups enhance lipophilicity, potentially influencing its behavior in biological systems and its utility in pharmaceuticals or agrochemicals. Additionally, due to the presence of fluorine, this compound may exhibit unique spectroscopic properties, making it useful in analytical chemistry. Safety data should be consulted, as fluorinated compounds can pose specific health and environmental risks.
Formula:C8H2F6O
InChI:InChI=1/C8H2F6O/c9-4-1-3(2-5(10)6(4)11)7(15)8(12,13)14/h1-2H
SMILES:c1c(cc(c(c1F)F)F)C(=O)C(F)(F)F
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.