
CAS 886369-99-9
:4-Fluoro-2-methyl-α-(trifluoromethyl)benzenemethanamine
Description:
4-Fluoro-2-methyl-α-(trifluoromethyl)benzenemethanamine, with the CAS number 886369-99-9, is an organic compound characterized by its aromatic structure, which includes a fluorine atom and a trifluoromethyl group attached to a benzene ring. This compound features a primary amine functional group, which contributes to its reactivity and potential applications in various chemical reactions. The presence of the trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry and drug development. The fluorine substituents can also affect the compound's electronic properties, stability, and solubility. Typically, compounds like this may exhibit unique interactions with biological targets, which can be explored for therapeutic purposes. Additionally, the compound's synthesis and characterization would involve standard organic chemistry techniques, including NMR and mass spectrometry, to confirm its structure and purity. Overall, 4-Fluoro-2-methyl-α-(trifluoromethyl)benzenemethanamine represents a class of fluorinated compounds that are valuable in both research and industrial applications.
Formula:C9H9F4N
InChI:InChI=1S/C9H9F4N/c1-5-4-6(10)2-3-7(5)8(14)9(11,12)13/h2-4,8H,14H2,1H3
InChI key:InChIKey=SXXHCHHVMARHSX-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(C)C=C(F)C=C1
Synonyms:- Benzenemethanamine, 4-fluoro-2-methyl-α-(trifluoromethyl)-
- 4-Fluoro-2-methyl-α-(trifluoromethyl)benzenemethanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.