CAS 88637-00-7

6-Methyl-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone

Description:

6-Methyl-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone, with the CAS number 88637-00-7, is a chemical compound that belongs to the class of pyrimidinones, which are characterized by a six-membered aromatic ring containing nitrogen atoms. This particular compound features a methyl group at the 6-position and a phenylmethylamino group at the 2-position of the pyrimidinone ring, contributing to its unique chemical properties. It is typically a solid at room temperature and may exhibit moderate solubility in organic solvents, depending on the specific conditions. The presence of both the methyl and phenylmethyl groups can influence its biological activity, making it of interest in medicinal chemistry. The compound may also participate in various chemical reactions typical of pyrimidinones, such as nucleophilic substitutions or condensation reactions. Its potential applications could span pharmaceuticals, where it may serve as a lead compound for drug development, particularly in targeting specific biological pathways. As with any chemical substance, safety data and handling precautions should be consulted before use.

Formula: C₁₂H₁₃N₃O

InChI: InChI=1S/C12H13N3O/c1-9-7-11(16)15-12(14-9)13-8-10-5-3-2-4-6-10/h2-7H,8H2,1H3,(H2,13,14,15,16)

InChI key: InChIKey=FZSLPJLMECZUHA-UHFFFAOYSA-N

SMILES: N(CC1=CC=CC=C1)C=2NC(C)=CC(=O)N2

Synonyms:

• 6-Methyl-2-[(phenylmethyl)amino]-4(3H)-pyrimidinone
• 2-(Benzylamino)-6-methylpyrimidin-4-ol
• 2-Benzylamino-6-methylpyrimidin-4-one
• 4(3H)-Pyrimidinone, 6-methyl-2-[(phenylmethyl)amino]-
• 4-Pyrimidinol, 2-(benzylamino)-6-methyl-