
CAS 886370-21-4
:3-Chloro-4-methyl-α-(trifluoromethyl)benzenemethanamine
Description:
3-Chloro-4-methyl-α-(trifluoromethyl)benzenemethanamine, with the CAS number 886370-21-4, is an organic compound characterized by its aromatic structure, which includes a chlorinated and trifluoromethyl-substituted benzene ring. The presence of the amino group (-NH2) indicates that it is an amine, which can participate in various chemical reactions, including nucleophilic substitutions and coupling reactions. The trifluoromethyl group (-CF3) is known for its electron-withdrawing properties, which can significantly influence the compound's reactivity and stability. This compound may exhibit unique physical properties such as solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical and agrochemical research. Additionally, the chlorinated and trifluoromethyl substituents can enhance lipophilicity, affecting the compound's interaction with biological membranes. Overall, the combination of these functional groups contributes to the compound's potential applications in various fields, including medicinal chemistry and materials science.
Formula:C9H9ClF3N
InChI:InChI=1S/C9H9ClF3N/c1-5-2-3-6(4-7(5)10)8(14)9(11,12)13/h2-4,8H,14H2,1H3
InChI key:InChIKey=HXJKOFXBVJMAFG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=CC(Cl)=C(C)C=C1
Synonyms:- 3-Chloro-4-methyl-α-(trifluoromethyl)benzenemethanamine
- Benzenemethanamine, 3-chloro-4-methyl-α-(trifluoromethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.