
CAS 886370-53-2
:2-(3-Fluorophenyl)-5-thiazolecarboxylic acid
Description:
2-(3-Fluorophenyl)-5-thiazolecarboxylic acid is an organic compound characterized by its thiazole and aromatic fluorophenyl moieties. The thiazole ring contributes to its heterocyclic nature, providing unique chemical reactivity and potential biological activity. The presence of the carboxylic acid functional group (-COOH) indicates that it can act as an acid, participating in various chemical reactions, including esterification and amidation. The fluorine atom on the phenyl ring enhances the compound's lipophilicity and can influence its electronic properties, potentially affecting its interactions with biological targets. This compound may exhibit interesting pharmacological properties, making it a candidate for further research in medicinal chemistry. Its structural features suggest potential applications in drug development, particularly in areas targeting specific enzymes or receptors. Additionally, the compound's stability and solubility characteristics would be important for its practical applications in synthesis and formulation. Overall, 2-(3-Fluorophenyl)-5-thiazolecarboxylic acid represents a versatile scaffold for further exploration in chemical and pharmaceutical research.
Formula:C10H6FNO2S
InChI:InChI=1S/C10H6FNO2S/c11-7-3-1-2-6(4-7)9-12-5-8(15-9)10(13)14/h1-5H,(H,13,14)
InChI key:InChIKey=BUYVYNQGJLVMMT-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1SC(=NC1)C2=CC(F)=CC=C2
Synonyms:- 2-(3-Fluorophenyl)-1,3-thiazole-5-carboxylic acid
- 5-Thiazolecarboxylic acid, 2-(3-fluorophenyl)-
- 2-(3-Fluorophenyl)-5-thiazolecarboxylic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.