CymitQuimica logo

CAS 886370-89-4

:

2-bromo-4-(2-pyridyl)thiazole

Description:
2-Bromo-4-(2-pyridyl)thiazole is a heterocyclic organic compound characterized by the presence of both a thiazole ring and a pyridine moiety. The thiazole ring contributes to its aromatic properties and potential reactivity, while the bromine substituent at the 2-position enhances its electrophilic character, making it useful in various chemical reactions. The 2-pyridyl group introduces nitrogen into the structure, which can participate in coordination chemistry and influence the compound's biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its unique structure allows it to be of interest in medicinal chemistry, particularly for its potential applications in drug development and as a building block in the synthesis of more complex molecules. Additionally, the presence of both bromine and nitrogen atoms can impart specific electronic properties, making it a candidate for studies in materials science and catalysis. Safety data should be consulted for handling, as halogenated compounds can pose health risks.
Formula:C8H5BrN2S
InChI:InChI=1/C8H5BrN2S/c9-8-11-7(5-12-8)6-3-1-2-4-10-6/h1-5H
InChI key:VRJPUEYEMIISBG-UHFFFAOYSA-N
SMILES:c1ccnc(c1)c1csc(Br)n1
Synonyms:
  • 2-(2-Bromo-1,3-thiazol-4-yl)pyridine
  • Pyridine, 2-(2-Bromo-4-Thiazolyl)-
Found 4 products.