CAS 886370-92-9
:2-bromo-5-methyl-4-(2-pyridyl)thiazole
Description:
2-Bromo-5-methyl-4-(2-pyridyl)thiazole is a heterocyclic organic compound characterized by its thiazole ring, which contains both sulfur and nitrogen atoms. The presence of a bromine atom at the 2-position and a methyl group at the 5-position of the thiazole ring contributes to its unique reactivity and physical properties. The 4-position features a pyridine ring, which enhances the compound's potential for coordination with metal ions and its biological activity. This compound is typically a solid at room temperature and may exhibit moderate solubility in organic solvents. Its structure suggests potential applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to the presence of functional groups that can participate in various chemical reactions. Additionally, the bromine substituent may impart specific electronic properties, influencing the compound's reactivity and interaction with biological targets. Overall, 2-bromo-5-methyl-4-(2-pyridyl)thiazole is of interest in both synthetic chemistry and medicinal chemistry contexts.
Formula:C9H7BrN2S
InChI:InChI=1/C9H7BrN2S/c1-6-8(12-9(10)13-6)7-4-2-3-5-11-7/h2-5H,1H3
SMILES:Cc1c(c2ccccn2)nc(Br)s1
Synonyms:- 2-(2-Bromo-5-methyl-1,3-thiazol-4-yl)pyridine
- Pyridine, 2-(2-Bromo-5-Methyl-4-Thiazolyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
