CymitQuimica logo

CAS 886370-95-2

:

3-(2-Bromo-4-thiazolyl)pyridine

Description:
3-(2-Bromo-4-thiazolyl)pyridine is an organic compound characterized by its heterocyclic structure, which includes both a pyridine and a thiazole ring. The presence of a bromine atom at the 2-position of the thiazole ring contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits properties such as moderate solubility in organic solvents and may show limited solubility in water due to its aromatic nature. It is often utilized in medicinal chemistry and material science, particularly in the development of pharmaceuticals and agrochemicals, owing to its biological activity and ability to interact with various biological targets. The compound's molecular structure allows for potential interactions through hydrogen bonding and π-π stacking, which can influence its behavior in biological systems. Additionally, the presence of halogen and heteroatoms in its structure can enhance its reactivity and facilitate further chemical modifications. As with many chemical substances, safety precautions should be observed when handling this compound due to its potential toxicity and environmental impact.
Formula:C8H5BrN2S
InChI:InChI=1S/C8H5BrN2S/c9-8-11-7(5-12-8)6-2-1-3-10-4-6/h1-5H
InChI key:InChIKey=ITEDZSJFELWCCO-UHFFFAOYSA-N
SMILES:BrC1=NC(=CS1)C=2C=CC=NC2
Synonyms:
  • 2-Bromo-4-Pyridin-3-Yl-1,3-Thiazole
  • 3-(2-Bromo-4-thiazolyl)pyridine
  • Pyridine, 3-(2-bromo-4-thiazolyl)-
Found 4 products.