
CAS 886370-98-5
:3-(2-Bromo-5-methyl-4-thiazolyl)pyridine
Description:
3-(2-Bromo-5-methyl-4-thiazolyl)pyridine is a chemical compound characterized by its unique structural features, which include a pyridine ring and a thiazole moiety. The presence of a bromine atom at the 2-position of the thiazole ring and a methyl group at the 5-position contributes to its reactivity and potential biological activity. This compound is typically classified as a heterocyclic organic compound, which often exhibits interesting pharmacological properties. It may be utilized in various fields, including medicinal chemistry and material science, due to its potential as a building block for more complex molecules. The compound's solubility, stability, and reactivity can vary based on the solvent and conditions used, making it important for researchers to consider these factors in experimental applications. Additionally, its molecular structure suggests potential interactions with biological targets, which could be explored in drug discovery and development. As with many brominated compounds, safety and handling precautions are essential due to the potential for toxicity.
Formula:C9H7BrN2S
InChI:InChI=1S/C9H7BrN2S/c1-6-8(12-9(10)13-6)7-3-2-4-11-5-7/h2-5H,1H3
InChI key:InChIKey=DSIVSFQLHJQNTR-UHFFFAOYSA-N
SMILES:CC1=C(N=C(Br)S1)C=2C=CC=NC2
Synonyms:- Pyridine, 3-(2-bromo-5-methyl-4-thiazolyl)-
- 3-(2-Bromo-5-methyl-4-thiazolyl)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.