CAS 886371-02-4

4-Chloro-2-fluoro-α-(trifluoromethyl)benzenemethanamine

Description:

4-Chloro-2-fluoro-α-(trifluoromethyl)benzenemethanamine, with the CAS number 886371-02-4, is a chemical compound characterized by its complex structure, which includes a benzene ring substituted with a chlorine atom, a fluorine atom, and a trifluoromethyl group, along with an amine functional group. This compound is typically a solid at room temperature and exhibits properties common to aromatic amines, such as potential reactivity due to the presence of the amine group. The trifluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in pharmaceutical research. The presence of halogens (chlorine and fluorine) can also affect the compound's stability, solubility, and reactivity, often leading to unique interactions in chemical reactions. Additionally, the compound's specific arrangement of substituents can impart distinct electronic properties, which may be relevant in applications such as drug design or materials science. Safety data and handling precautions should be considered due to the potential toxicity associated with halogenated compounds.

Formula: C₈H₆ClF₄N

InChI: InChI=1S/C8H6ClF4N/c9-4-1-2-5(6(10)3-4)7(14)8(11,12)13/h1-3,7H,14H2

InChI key: InChIKey=NHOWTHPMQVZUQI-UHFFFAOYSA-N

SMILES: C(C(F)(F)F)(N)C1=C(F)C=C(Cl)C=C1

Synonyms:

• Benzenemethanamine, 4-chloro-2-fluoro-α-(trifluoromethyl)-
• 4-Chloro-2-fluoro-α-(trifluoromethyl)benzenemethanamine