CAS 886371-13-7
:1-(2-Bromo-3-pyridinyl)-2,2,2-trifluoroethanone
Description:
1-(2-Bromo-3-pyridinyl)-2,2,2-trifluoroethanone is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a trifluoroethanone moiety. This compound typically exhibits a molecular formula that reflects its complex arrangement of atoms, including carbon, hydrogen, bromine, and fluorine. The presence of the trifluoroethanone group imparts significant polarity and reactivity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The bromine substituent enhances the compound's electrophilic character, facilitating various chemical reactions such as nucleophilic substitutions. Additionally, the pyridine ring contributes to the compound's aromatic stability and potential interactions with biological targets. Due to its fluorinated structure, it may also exhibit unique properties such as increased lipophilicity and altered metabolic stability. Overall, this compound is of interest in medicinal chemistry and materials science for its potential applications and reactivity.
Formula:C7H3BrF3NO
InChI:InChI=1S/C7H3BrF3NO/c8-6-4(2-1-3-12-6)5(13)7(9,10)11/h1-3H
InChI key:InChIKey=RSHVARBDWGSCQS-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(Br)N=CC=C1
Synonyms:- 1-(2-Bromo-3-pyridinyl)-2,2,2-trifluoroethanone
- 1-(2-Bromopyridin-3-yl)-2,2,2-trifluoroethan-1-one
- Ethanone, 1-(2-bromo-3-pyridinyl)-2,2,2-trifluoro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
