CymitQuimica logo

CAS 886371-16-0

:

2-Pyridinesulfonyl chloride, 3,5-dichloro-

Description:
2-Pyridinesulfonyl chloride, 3,5-dichloro- is an organic compound characterized by the presence of a pyridine ring substituted with a sulfonyl chloride group and two chlorine atoms at the 3 and 5 positions of the ring. This compound is typically a colorless to pale yellow liquid or solid, depending on its form and purity. It is known for its reactivity, particularly due to the sulfonyl chloride functional group, which can participate in nucleophilic substitution reactions, making it useful in organic synthesis, especially for the preparation of sulfonamides and other derivatives. The presence of chlorine atoms enhances its electrophilic character, allowing it to react with various nucleophiles. Additionally, 2-Pyridinesulfonyl chloride, 3,5-dichloro- is sensitive to moisture and should be handled with care, as it can release hydrochloric acid upon hydrolysis. Proper safety precautions, including the use of personal protective equipment, are essential when working with this compound due to its potential irritant properties.
Formula:C5H2Cl3NO2S
InChI:InChI=1S/C5H2Cl3NO2S/c6-3-1-4(7)5(9-2-3)12(8,10)11/h1-2H
InChI key:InChIKey=SABQHHSBPBKFPQ-UHFFFAOYSA-N
SMILES:S(Cl)(=O)(=O)C1=C(Cl)C=C(Cl)C=N1
Synonyms:
  • 3,5-Dichloropyridine-2-sulfonyl chloride
  • 2-Pyridinesulfonyl chloride, 3,5-dichloro-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.