CymitQuimica logo

CAS 886371-21-7

:

2-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine

Description:
2-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with a bromine atom and a trifluoromethyl group. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and potential applications in organic synthesis. The trifluoromethyl group is known for its electron-withdrawing properties, which can enhance the compound's stability and alter its electronic characteristics, making it useful in medicinal chemistry and agrochemical applications. The amine functional group contributes to the compound's basicity and potential for forming hydrogen bonds, which can be significant in biological interactions. This compound may exhibit specific biological activities, making it of interest in pharmaceutical research. Its CAS number, 886371-21-7, allows for precise identification and retrieval of information regarding its properties, safety data, and regulatory status. Overall, 2-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine is a versatile compound with potential applications in various fields of chemistry.
Formula:C7H6BrF3N2
InChI:InChI=1S/C7H6BrF3N2/c8-6-4(2-1-3-13-6)5(12)7(9,10)11/h1-3,5H,12H2
InChI key:InChIKey=GMMQHKBDGCGMCM-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(Br)N=CC=C1
Synonyms:
  • 2-Bromo-α-(trifluoromethyl)-3-pyridinemethanamine
  • 3-Pyridinemethanamine, 2-bromo-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.