CAS 886371-28-4
:3-Bromo-6-chloroimidazo[1,2-a]pyridine
Description:
3-Bromo-6-chloroimidazo[1,2-a]pyridine is a heterocyclic compound characterized by its fused imidazole and pyridine rings, which contribute to its unique chemical properties. The presence of bromine and chlorine substituents at the 3 and 6 positions, respectively, enhances its reactivity and potential for forming various derivatives. This compound typically exhibits moderate to high solubility in polar organic solvents, making it suitable for various chemical reactions and applications in medicinal chemistry. Its structure allows for potential interactions with biological targets, which has led to interest in its pharmacological properties. Additionally, the presence of halogen atoms can influence the compound's electronic properties, potentially affecting its behavior in biological systems. As a result, 3-Bromo-6-chloroimidazo[1,2-a]pyridine is often studied for its potential use in drug development and as a building block in the synthesis of more complex molecules. Safety and handling precautions should be observed due to the presence of halogens, which can pose health risks.
Formula:C7H4BrClN2
InChI:InChI=1/C7H4BrClN2/c8-6-3-10-7-2-1-5(9)4-11(6)7/h1-4H
SMILES:c1cc2ncc(Br)n2cc1Cl
Synonyms:- Imidazo[1,2-A]Pyridine, 3-Bromo-6-Chloro-
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 5 products.
3-Bromo-6-chloroimidazo[1,2-a]pyridine, 95%
CAS:This Thermo Scientific Chemicals brand product was originally part of the Alfa Aesar product portfolio. Some documentation and label information may refer to the legacy brand. The original Alfa Aesar product / item code or SKU reference has not changed as a part of the brand transition to Thermo Sci
Formula:C7H4BrClN2Purity:95%Color and Shape:Pale brown, PowderMolecular weight:231.483-Bromo-6-chloroimidazo[1,2-a]pyridine
CAS:Formula:C7H4BrClN2Purity:95%Color and Shape:SolidMolecular weight:231.47713-Bromo-6-chloroimidazo[1,2-a]pyridine
CAS:3-Bromo-6-chloroimidazo[1,2-a]pyridineFormula:C7H4BrClN2Purity:≥95%Color and Shape: solidMolecular weight:231.48g/mol3-Bromo-6-chloroimidazo[1,2-a]pyridine
CAS:Formula:C7H4BrClN2Purity:96%Color and Shape:SolidMolecular weight:231.483-Bromo-6-chloroimidazo[1,2-a]pyridine
CAS:Versatile small molecule scaffoldFormula:C7H4BrClN2Purity:Min. 95%Molecular weight:231.48 g/mol




