CymitQuimica logo

CAS 886371-29-5

:

1-(2-chloro-6-methyl-phenyl)-2,2,2-trifluoro-ethanone

Description:
1-(2-Chloro-6-methyl-phenyl)-2,2,2-trifluoro-ethanone, identified by its CAS number 886371-29-5, is an organic compound characterized by the presence of a chloro-substituted aromatic ring and a trifluoroacetyl functional group. This compound typically exhibits a pale yellow to light brown appearance and is likely to be a solid at room temperature. The presence of the trifluoroacetyl group imparts significant polarity and can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The chloro and methyl substituents on the aromatic ring can affect the compound's electronic properties, potentially enhancing its reactivity in electrophilic aromatic substitution reactions. Additionally, the trifluoromethyl group is known for its ability to stabilize negative charges, which can be advantageous in certain synthetic pathways. Safety data sheets would indicate that it should be handled with care due to potential toxicity and environmental concerns, as is common with halogenated organic compounds. Overall, this compound may find applications in pharmaceuticals or agrochemicals, depending on its specific reactivity and properties.
Formula:C9H6ClF3O
InChI:InChI=1/C9H6ClF3O/c1-5-3-2-4-6(10)7(5)8(14)9(11,12)13/h2-4H,1H3
SMILES:Cc1cccc(c1C(=O)C(F)(F)F)Cl
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.