CymitQuimica logo

CAS 886371-40-0

:

2,2,2-Trifluoro-1-(2,3,4,5-tetramethylphenyl)ethanone

Description:
2,2,2-Trifluoro-1-(2,3,4,5-tetramethylphenyl)ethanone is an organic compound characterized by its unique structure, which includes a trifluoroacetyl group and a highly substituted aromatic ring. The presence of three fluorine atoms contributes to its distinctive chemical properties, such as increased electronegativity and potential reactivity in various chemical reactions. The compound is likely to exhibit significant lipophilicity due to the bulky tetramethylphenyl group, which can influence its solubility and interaction with biological systems. Additionally, the trifluoromethyl group can enhance the compound's stability and resistance to metabolic degradation. This substance may be of interest in fields such as medicinal chemistry and materials science, where fluorinated compounds are often explored for their unique properties. Safety considerations should be taken into account when handling this compound, as fluorinated organic compounds can pose environmental and health risks. Overall, 2,2,2-Trifluoro-1-(2,3,4,5-tetramethylphenyl)ethanone represents a complex and potentially useful chemical entity in various applications.
Formula:C12H13F3O
InChI:InChI=1S/C12H13F3O/c1-6-5-10(11(16)12(13,14)15)9(4)8(3)7(6)2/h5H,1-4H3
InChI key:InChIKey=UFDHGEQYTVLOSG-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(=O)C1=C(C)C(C)=C(C)C(C)=C1
Synonyms:
  • 2,2,2-Trifluoro-1-(2,3,4,5-tetramethylphenyl)ethanone
  • Ethanone, 2,2,2-trifluoro-1-(2,3,4,5-tetramethylphenyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.