CymitQuimica logo

CAS 886371-46-6

:

2,4,6-Trichloro-α-(trifluoromethyl)benzenemethanamine

Description:
2,4,6-Trichloro-α-(trifluoromethyl)benzenemethanamine, identified by its CAS number 886371-46-6, is a synthetic organic compound characterized by the presence of multiple halogen substituents and an amine functional group. This compound features a benzene ring with three chlorine atoms positioned at the 2, 4, and 6 positions, along with a trifluoromethyl group attached to the alpha carbon of the benzenemethanamine moiety. The presence of these electronegative halogens contributes to its chemical stability and potential reactivity, influencing its solubility and interaction with other substances. Typically, compounds with such halogenated structures exhibit significant biological activity, making them of interest in various fields, including pharmaceuticals and agrochemicals. Additionally, the trifluoromethyl group is known to enhance lipophilicity, which can affect the compound's bioavailability and pharmacokinetics. Safety and handling considerations are essential due to the potential toxicity associated with halogenated compounds, necessitating appropriate precautions during synthesis and application.
Formula:C8H5Cl3F3N
InChI:InChI=1S/C8H5Cl3F3N/c9-3-1-4(10)6(5(11)2-3)7(15)8(12,13)14/h1-2,7H,15H2
InChI key:InChIKey=TVFRYSCTNPAJMW-UHFFFAOYSA-N
SMILES:C(C(F)(F)F)(N)C1=C(Cl)C=C(Cl)C=C1Cl
Synonyms:
  • 2,4,6-Trichloro-α-(trifluoromethyl)benzenemethanamine
  • Benzenemethanamine, 2,4,6-trichloro-α-(trifluoromethyl)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.