CAS 886371-81-9

4-Amino-N-methyl-2-pyridinemethanamine

Description:

4-Amino-N-methyl-2-pyridinemethanamine, identified by its CAS number 886371-81-9, is an organic compound characterized by the presence of an amino group and a pyridine ring. This compound features a methyl group attached to the nitrogen atom of the amino group, which contributes to its basicity and potential reactivity. The pyridine ring, a six-membered aromatic heterocycle containing one nitrogen atom, imparts unique electronic properties, making the compound useful in various chemical reactions and applications. Typically, such compounds exhibit solubility in polar solvents due to the presence of the amino group, which can engage in hydrogen bonding. The presence of both amino and pyridine functionalities suggests potential applications in pharmaceuticals, agrochemicals, or as intermediates in organic synthesis. Additionally, the compound's structure may influence its biological activity, making it of interest in medicinal chemistry. Safety and handling precautions should be observed, as with any chemical substance, due to potential toxicity or reactivity.

Formula: C₇H₁₁N₃

InChI: InChI=1S/C7H11N3/c1-9-5-7-4-6(8)2-3-10-7/h2-4,9H,5H2,1H3,(H2,8,10)

InChI key: InChIKey=IKQLECATFMXRAL-UHFFFAOYSA-N

SMILES: C(NC)C1=CC(N)=CC=N1

Synonyms:

• 2-Pyridinemethanamine, 4-amino-N-methyl-
• 4-Amino-N-methyl-2-pyridinemethanamine

2-[(Methylamino)methyl]pyridin-4-amine

CAS: 886371-81-9

Versatile small molecule scaffold

Formula: C₇H₁₁N₃

Purity: Min. 95%

Molecular weight: 137.18 g/mol

Ref: 3D-LKB37181