CymitQuimica logo

CAS 886371-82-0

:

7-Bromoimidazo[1,2-a]pyridine-2-methanamine

Description:
7-Bromoimidazo[1,2-a]pyridine-2-methanamine is a heterocyclic organic compound characterized by its imidazo and pyridine ring structures, which contribute to its unique chemical properties. The presence of a bromine atom at the 7-position of the imidazo ring enhances its reactivity and potential for substitution reactions. The methanamine group at the 2-position introduces an amine functionality, making the compound a potential candidate for various chemical reactions, including nucleophilic substitutions and coupling reactions. This compound may exhibit biological activity, making it of interest in medicinal chemistry and drug development. Its molecular structure allows for interactions with biological targets, potentially influencing pharmacological properties. Additionally, the compound's solubility, stability, and reactivity can be influenced by the presence of the bromine atom and the amine group, which may affect its application in synthetic chemistry and material science. Overall, 7-Bromoimidazo[1,2-a]pyridine-2-methanamine is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C8H8BrN3
InChI:InChI=1S/C8H8BrN3/c9-6-1-2-12-5-7(4-10)11-8(12)3-6/h1-3,5H,4,10H2
InChI key:InChIKey=WSBKXCWOMDDXEM-UHFFFAOYSA-N
SMILES:C(N)C1=CN2C(=N1)C=C(Br)C=C2
Synonyms:
  • 7-Bromoimidazo[1,2-a]pyridine-2-methanamine
  • C-(7-Bromoimidazo[1,2-a]pyridin-2-yl)methylamine
  • Imidazo[1,2-a]pyridine-2-methanamine, 7-bromo-
  • [7-Bromoimidazo[1,2-a]pyridin-2-yl]methanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.