
CAS 886372-09-4
:4-Chloro-3-methyl-2-pyridinemethanamine
Description:
4-Chloro-3-methyl-2-pyridinemethanamine, with the CAS number 886372-09-4, is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a chloro substituent at the 4-position and a methyl group at the 3-position of the pyridine ring, along with an amine group attached to a methylene bridge at the 2-position. The presence of these functional groups contributes to its chemical reactivity and potential applications in various fields, including pharmaceuticals and agrochemicals. The compound is likely to exhibit basic properties due to the amine group, which can participate in hydrogen bonding and act as a nucleophile in chemical reactions. Additionally, the chloro and methyl groups can influence the compound's lipophilicity and solubility in organic solvents. Overall, 4-Chloro-3-methyl-2-pyridinemethanamine is a versatile compound with potential utility in synthetic organic chemistry and medicinal chemistry.
Formula:C7H9ClN2
InChI:InChI=1S/C7H9ClN2/c1-5-6(8)2-3-10-7(5)4-9/h2-3H,4,9H2,1H3
InChI key:InChIKey=DHBHFYXQGMWKDG-UHFFFAOYSA-N
SMILES:C(N)C1=C(C)C(Cl)=CC=N1
Synonyms:- (4-Chloro-3-methylpyridin-2-yl)methanamine
- 4-Chloro-3-methyl-2-pyridinemethanamine
- 2-Pyridinemethanamine, 4-chloro-3-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.