CymitQuimica logo

CAS 886372-21-0

:

4-Methoxy-3-methyl-2-pyridinecarbonitrile

Description:
4-Methoxy-3-methyl-2-pyridinecarbonitrile is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a methoxy group (-OCH3) at the 4-position and a methyl group (-CH3) at the 3-position contributes to its unique chemical properties. The cyano group (-C≡N) at the 2-position enhances its reactivity, making it useful in various synthetic applications. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar organic solvents. Its structure suggests potential applications in pharmaceuticals and agrochemicals, particularly as an intermediate in the synthesis of biologically active molecules. Additionally, the presence of both electron-donating (methoxy and methyl) and electron-withdrawing (cyano) groups can influence its electronic properties, making it a subject of interest in studies related to molecular interactions and reactivity. Safety data should be consulted for handling, as with any chemical substance, to ensure proper precautions are taken.
Formula:C8H8N2O
InChI:InChI=1S/C8H8N2O/c1-6-7(5-9)10-4-3-8(6)11-2/h3-4H,1-2H3
InChI key:InChIKey=PBUYPSKEEQASED-UHFFFAOYSA-N
SMILES:O(C)C=1C(C)=C(C#N)N=CC1
Synonyms:
  • 4-Methoxy-3-methyl-2-pyridinecarbonitrile
  • 2-Pyridinecarbonitrile, 4-methoxy-3-methyl-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.