
CAS 886372-33-4
:3-Methyl-4-(trifluoromethoxy)-2-pyridinecarboxaldehyde
Description:
3-Methyl-4-(trifluoromethoxy)-2-pyridinecarboxaldehyde is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a trifluoromethoxy group, which significantly influence its chemical properties and reactivity. The presence of the trifluoromethoxy group enhances the compound's lipophilicity and may affect its biological activity, making it of interest in medicinal chemistry. The aldehyde functional group contributes to its reactivity, allowing it to participate in various chemical reactions, such as condensation and nucleophilic addition. Additionally, the compound's molecular structure suggests potential applications in the synthesis of more complex molecules or as an intermediate in pharmaceutical development. Its unique combination of functional groups may also impart specific physical properties, such as solubility in organic solvents and stability under certain conditions. Overall, 3-Methyl-4-(trifluoromethoxy)-2-pyridinecarboxaldehyde represents a versatile building block in organic synthesis and drug discovery.
Formula:C8H6F3NO2
InChI:InChI=1S/C8H6F3NO2/c1-5-6(4-13)12-3-2-7(5)14-8(9,10)11/h2-4H,1H3
InChI key:InChIKey=OMXRHULQJXCFTF-UHFFFAOYSA-N
SMILES:O(C(F)(F)F)C=1C(C)=C(C=O)N=CC1
Synonyms:- 2-Pyridinecarboxaldehyde, 3-methyl-4-(trifluoromethoxy)-
- 3-Methyl-4-(trifluoromethoxy)-2-pyridinecarboxaldehyde
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.