
CAS 886372-37-8
:3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinemethanamine
Description:
3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinemethanamine is a chemical compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. This compound features a methyl group and a trifluoroethoxy substituent, which significantly influences its chemical properties and reactivity. The presence of the trifluoroethoxy group imparts unique characteristics, such as increased lipophilicity and potential for hydrogen bonding, which can affect its solubility and interaction with biological systems. The amine functional group in the structure suggests that it may exhibit basic properties and can participate in various chemical reactions, including nucleophilic substitutions. Additionally, the compound may have applications in medicinal chemistry, particularly in the development of pharmaceuticals, due to its potential biological activity. Its specific properties, such as melting point, boiling point, and spectral characteristics, would require experimental determination or reference to detailed chemical databases for precise values.
Formula:C9H11F3N2O
InChI:InChI=1S/C9H11F3N2O/c1-6-7(4-13)14-3-2-8(6)15-5-9(10,11)12/h2-3H,4-5,13H2,1H3
InChI key:InChIKey=SAXOVUZQQCWTQZ-UHFFFAOYSA-N
SMILES:O(CC(F)(F)F)C=1C(C)=C(CN)N=CC1
Synonyms:- 3-Methyl-4-(2,2,2-trifluoroethoxy)-2-pyridinemethanamine
- 2-Pyridinemethanamine, 3-methyl-4-(2,2,2-trifluoroethoxy)-
- [3-Methyl-4-(2,2,2-trifluoroethoxy)pyridin-2-yl]methanamine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.