CAS 886372-63-0

5-fluoro-6-methoxy-pyridin-3-amine

Description:

5-Fluoro-6-methoxy-pyridin-3-amine is an organic compound characterized by its pyridine ring structure, which is a six-membered aromatic ring containing one nitrogen atom. The presence of a fluorine atom at the 5-position and a methoxy group (-OCH3) at the 6-position, along with an amino group (-NH2) at the 3-position, contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the presence of the amino and methoxy functional groups. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of pharmaceuticals, as modifications to the pyridine ring can influence biological activity. Additionally, the presence of the fluorine atom can enhance metabolic stability and lipophilicity, making it a valuable candidate for drug design. Safety and handling precautions should be observed, as with all chemical substances, to mitigate any potential hazards associated with its use.

Formula: C₆H₇FN₂O

InChI: InChI=1/C6H7FN2O/c1-10-6-5(7)2-4(8)3-9-6/h2-3H,8H2,1H3

SMILES: COc1c(cc(cn1)N)F

Synonyms:

• 3-Pyridinamine, 5-Fluoro-6-Methoxy-
• 5-Fluoro-6-methoxypyridin-3-amine
• 3-Amino-5-fluoro-6-methoxypyridine
• 5-Fluoro-6-Methoxy-Pyridin-3-Ylamine

3-Amino-5-fluoro-6-methoxypyridine

CAS: 886372-63-0

Formula: C₆H₇FN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.1310

Ref: IN-DA004AED

5-Fluoro-6-methoxypyridin-3-amine

CAS: 886372-63-0

5-Fluoro-6-methoxypyridin-3-amine

Formula: C₆H₇FN₂O

Purity: ≥95%

Color and Shape: light brown solid

Molecular weight: 142.13g/mol

Ref: 54-PC402048

3-Amino-5-fluoro-6-methoxypyridine

CAS: 886372-63-0

Formula: C₆H₇FN₂O

Purity: 98%

Color and Shape: Solid

Molecular weight: 142.133

Ref: 10-F208893