CAS 886372-71-0

5-Bromo-2-chloro-N-methyl-3-pyridinamine

Description:

5-Bromo-2-chloro-N-methyl-3-pyridinamine is an organic compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing nitrogen. The presence of bromine and chlorine substituents at the 5 and 2 positions, respectively, contributes to its reactivity and potential applications in various chemical reactions. The N-methyl group indicates that there is a methyl group attached to the nitrogen atom, which can influence the compound's solubility and biological activity. This compound may exhibit properties typical of halogenated amines, such as being a potential intermediate in the synthesis of pharmaceuticals or agrochemicals. Its molecular structure suggests it could participate in nucleophilic substitution reactions due to the presence of the halogens. Additionally, the compound's characteristics, including its melting point, boiling point, and solubility, would depend on the specific interactions of its functional groups and the overall molecular geometry. Safety data and handling precautions should be considered due to the presence of halogens, which can pose health and environmental risks.

Formula: C₆H₆BrClN₂

InChI: InChI=1S/C6H6BrClN2/c1-9-5-2-4(7)3-10-6(5)8/h2-3,9H,1H3

InChI key: InChIKey=DGFFPZUWFKKUAI-UHFFFAOYSA-N

SMILES: N(C)C1=C(Cl)N=CC(Br)=C1

Synonyms:

• 5-Bromo-2-chloro-N-methyl-3-pyridinamine
• 3-Pyridinamine, 5-bromo-2-chloro-N-methyl-