CAS 886372-73-2

N-(5-Bromo-2-chloro-3-pyridinyl)acetamide

Description:

N-(5-Bromo-2-chloro-3-pyridinyl)acetamide is a chemical compound characterized by its unique structure, which includes a pyridine ring substituted with both bromine and chlorine atoms. The presence of these halogens contributes to its reactivity and potential biological activity. The acetamide functional group indicates that the compound may exhibit properties typical of amides, such as hydrogen bonding capabilities, which can influence its solubility and interaction with biological targets. This compound is often studied in the context of medicinal chemistry, where its structural features may be linked to specific pharmacological effects. Additionally, the presence of halogens can enhance lipophilicity, potentially affecting the compound's absorption and distribution in biological systems. As with many halogenated compounds, it is essential to consider environmental and safety aspects, including potential toxicity and degradation pathways. Overall, N-(5-Bromo-2-chloro-3-pyridinyl)acetamide represents a class of compounds that may have significant implications in drug discovery and development.

Formula: C₇H₆BrClN₂O

InChI: InChI=1S/C7H6BrClN2O/c1-4(12)11-6-2-5(8)3-10-7(6)9/h2-3H,1H3,(H,11,12)

InChI key: InChIKey=ARZFDCREOFGOFF-UHFFFAOYSA-N

SMILES: N(C(C)=O)C1=C(Cl)N=CC(Br)=C1

Synonyms:

• N-(5-Bromo-2-chloro-3-pyridinyl)acetamide
• Acetamide, N-(5-bromo-2-chloro-3-pyridinyl)-