CAS 886372-86-7
:5-Bromo-3-nitro-2(1H)-pyridinethione
Description:
5-Bromo-3-nitro-2(1H)-pyridinethione is a heterocyclic organic compound characterized by its pyridine ring, which is substituted at the 5-position with a bromine atom and at the 3-position with a nitro group. The presence of the thione functional group (–C=S) at the 2-position contributes to its reactivity and potential applications in various chemical reactions. This compound typically exhibits a yellow to orange color and is soluble in organic solvents, making it useful in synthetic organic chemistry. Its molecular structure allows for various interactions, including hydrogen bonding and electrophilic substitution, which can be exploited in medicinal chemistry and material science. The compound's unique combination of bromine and nitro substituents may impart specific biological activities, making it of interest for research in pharmacology. As with many chemical substances, safety precautions should be observed when handling it, as it may pose health risks or environmental hazards.
Formula:C5H3BrN2O2S
InChI:InChI=1S/C5H3BrN2O2S/c6-3-1-4(8(9)10)5(11)7-2-3/h1-2H,(H,7,11)
InChI key:InChIKey=YINMWDRWADCKEZ-UHFFFAOYSA-N
SMILES:N(=O)(=O)C=1C(=S)NC=C(Br)C1
Synonyms:- 5-Bromo-3-nitro-2(1H)-pyridinethione
- 2(1H)-Pyridinethione, 5-bromo-3-nitro-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
