CymitQuimica logo

CAS 88640-67-9

:

3-Butyl-5-methoxyphenol

Description:
3-Butyl-5-methoxyphenol, with the CAS number 88640-67-9, is an organic compound characterized by its phenolic structure. It features a butyl group and a methoxy group attached to a phenol ring, which contributes to its unique chemical properties. This compound is typically a colorless to pale yellow liquid or solid, depending on its purity and temperature. It is known for its antioxidant properties, making it useful in various applications, including cosmetics and food preservation. The presence of the methoxy group enhances its solubility in organic solvents, while the butyl group can influence its hydrophobic characteristics. Additionally, 3-butyl-5-methoxyphenol may exhibit biological activity, which has led to research into its potential uses in pharmaceuticals and as a preservative. As with many phenolic compounds, it may also have implications for environmental and health safety, necessitating careful handling and assessment of its toxicological profile. Overall, this compound represents a versatile structure with applications across multiple fields.
Formula:C11H16O2
InChI:InChI=1S/C11H16O2/c1-3-4-5-9-6-10(12)8-11(7-9)13-2/h6-8,12H,3-5H2,1-2H3
InChI key:InChIKey=SVMOUQOWNUSFDE-UHFFFAOYSA-N
SMILES:C(CCC)C1=CC(OC)=CC(O)=C1
Synonyms:
  • 3-Butyl-5-methoxyphenol
  • Phenol, 3-butyl-5-methoxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.