
CAS 88640-81-7
:4-[(3-Nitrobenzoyl)amino]benzoic acid hydrazide
Description:
4-[(3-Nitrobenzoyl)amino]benzoic acid hydrazide, identified by its CAS number 88640-81-7, is a chemical compound that features a hydrazide functional group, which is characterized by the presence of a hydrazine moiety (-NH-NH2) linked to a carboxylic acid. This compound exhibits both hydrophilic and hydrophobic properties due to the presence of the nitrobenzoyl group and the benzoic acid moiety, making it potentially useful in various applications, including pharmaceuticals and agrochemicals. The nitro group (-NO2) contributes to its electron-withdrawing characteristics, which can influence its reactivity and interaction with biological systems. Additionally, the compound may exhibit biological activity, such as antimicrobial or anti-inflammatory properties, although specific biological effects would depend on further empirical studies. Its solubility, stability, and reactivity can vary based on environmental conditions, such as pH and temperature. Overall, 4-[(3-Nitrobenzoyl)amino]benzoic acid hydrazide is a versatile compound with potential applications in medicinal chemistry and material science.
Formula:C14H12N4O4
InChI:InChI=1S/C14H12N4O4/c15-17-14(20)9-4-6-11(7-5-9)16-13(19)10-2-1-3-12(8-10)18(21)22/h1-8H,15H2,(H,16,19)(H,17,20)
InChI key:InChIKey=LWPBSTZHELLDKR-UHFFFAOYSA-N
SMILES:C(NC1=CC=C(C(NN)=O)C=C1)(=O)C2=CC(N(=O)=O)=CC=C2
Synonyms:- 4-[(3-Nitrobenzoyl)amino]benzoic acid hydrazide
- Benzoic acid, 4-[(3-nitrobenzoyl)amino]-, hydrazide
- p-(m-Nitrobenzamido)benzhydrazide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
