CymitQuimica logo

CAS 88642-86-8

:

Alanine, 3-[(2-boronoethyl)thio]-

Description:
Alanine, 3-[(2-boronoethyl)thio]- is a chemical compound that features a boron-containing functional group, which is significant in various biochemical applications, particularly in the context of drug design and molecular biology. This compound is characterized by the presence of an alanine backbone, an amino acid known for its role in protein synthesis and metabolism. The addition of a thioether group, specifically a boronoethyl thio group, enhances its reactivity and potential for forming covalent bonds with other biomolecules. The boron atom in the structure is notable for its ability to form stable complexes with certain ligands, making it useful in targeted therapies and as a tool in chemical biology. The compound's properties, such as solubility, stability, and reactivity, can be influenced by the presence of the boron and sulfur atoms, which may also affect its biological activity. Overall, Alanine, 3-[(2-boronoethyl)thio]- represents a unique intersection of organic chemistry and biochemistry, with potential applications in therapeutic development and molecular probes.
Formula:C5H12BNO4S
InChI:InChI=1S/C5H12BNO4S/c7-4(5(8)9)3-12-2-1-6(10)11/h4,10-11H,1-3,7H2,(H,8,9)
InChI key:InChIKey=OTJHLDXXJHAZTN-UHFFFAOYSA-N
SMILES:C(SCCB(O)O)C(C(O)=O)N
Synonyms:
  • Alanine, 3-[(2-boronoethyl)thio]-
  • NSC 77838
  • 2-Amino-3-(2-boronoethylsulfanyl)propanoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.