CymitQuimica logo

CAS 886469-43-8

:

Phenyl[4-(3,6,9,12-tetraoxatricos-13-en-1-yloxy)phenyl]methanone

Description:
Phenyl[4-(3,6,9,12-tetraoxatricos-13-en-1-yloxy)phenyl]methanone, identified by its CAS number 886469-43-8, is a complex organic compound characterized by its unique structural features. It contains a phenyl group and a methanone functional group, which contribute to its reactivity and potential applications in organic synthesis. The presence of a tetraoxatricos moiety suggests that the compound may exhibit interesting solubility properties and could participate in various chemical reactions, including those involving ether linkages due to the ether oxygen atoms in its structure. This compound may also possess photophysical properties, making it suitable for applications in materials science, such as in the development of organic light-emitting diodes (OLEDs) or other optoelectronic devices. Additionally, the presence of multiple oxygen atoms may enhance its polarity and solubility in polar solvents. Overall, the unique combination of functional groups in this compound suggests potential utility in advanced chemical applications, although specific properties such as melting point, boiling point, and spectral data would require further investigation for comprehensive characterization.
Formula:C32H46O6
InChI:InChI=1S/C32H46O6/c1-2-3-4-5-6-7-8-9-13-20-34-21-22-35-23-24-36-25-26-37-27-28-38-31-18-16-30(17-19-31)32(33)29-14-11-10-12-15-29/h10-20H,2-9,21-28H2,1H3
InChI key:InChIKey=OZHFCDRHGBBUEO-UHFFFAOYSA-N
SMILES:C(=O)(C1=CC=C(OCCOCCOCCOCCOC=CCCCCCCCCC)C=C1)C2=CC=CC=C2
Synonyms:
  • Phenyl[4-(3,6,9,12-tetraoxatricos-13-en-1-yloxy)phenyl]methanone
  • Methanone, phenyl[4-(3,6,9,12-tetraoxatricos-13-en-1-yloxy)phenyl]-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.