
CAS 88649-67-6
:Methyl 5-(2-bromophenyl)-2-furancarboximidate
Description:
Methyl 5-(2-bromophenyl)-2-furancarboximidate is an organic compound characterized by its unique structure, which includes a furan ring, a carboximidate functional group, and a bromophenyl substituent. The presence of the furan ring contributes to its aromatic properties, while the carboximidate group can participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. The bromine atom in the 2-position of the phenyl ring enhances the compound's reactivity, making it a potential candidate for further chemical transformations. This compound is typically used in organic synthesis and medicinal chemistry, where its derivatives may exhibit biological activity. Its solubility and stability can vary depending on the solvent and conditions used, and it should be handled with care due to the presence of the bromine atom, which can pose health and environmental risks. As with many organic compounds, proper safety protocols should be followed when working with this substance in a laboratory setting.
Formula:C12H10BrNO2
InChI:InChI=1S/C12H10BrNO2/c1-15-12(14)11-7-6-10(16-11)8-4-2-3-5-9(8)13/h2-7,14H,1H3
InChI key:InChIKey=RBGXPGBQFQSQOF-UHFFFAOYSA-N
SMILES:BrC1=C(C=CC=C1)C=2OC(C(OC)=N)=CC2
Synonyms:- Methyl 5-(2-bromophenyl)-2-furancarboximidate
- 2-Furancarboximidic acid, 5-(2-bromophenyl)-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-Furancarboximidic acid, 5-(2-bromophenyl)-, methyl ester
CAS:Formula:C12H10BrNO2Molecular weight:280.1173
