CAS 88649-67-6

Methyl 5-(2-bromophenyl)-2-furancarboximidate

Description:

Methyl 5-(2-bromophenyl)-2-furancarboximidate is an organic compound characterized by its unique structure, which includes a furan ring, a carboximidate functional group, and a bromophenyl substituent. The presence of the furan ring contributes to its aromatic properties, while the carboximidate group can participate in various chemical reactions, such as nucleophilic substitutions or cycloadditions. The bromine atom in the 2-position of the phenyl ring enhances the compound's reactivity, making it a potential candidate for further chemical transformations. This compound is typically used in organic synthesis and medicinal chemistry, where its derivatives may exhibit biological activity. Its solubility and stability can vary depending on the solvent and conditions used, and it should be handled with care due to the presence of the bromine atom, which can pose health and environmental risks. As with many organic compounds, proper safety protocols should be followed when working with this substance in a laboratory setting.

Formula: C₁₂H₁₀BrNO₂

InChI: InChI=1S/C12H10BrNO2/c1-15-12(14)11-7-6-10(16-11)8-4-2-3-5-9(8)13/h2-7,14H,1H3

InChI key: InChIKey=RBGXPGBQFQSQOF-UHFFFAOYSA-N

SMILES: BrC1=C(C=CC=C1)C=2OC(C(OC)=N)=CC2

Synonyms:

• Methyl 5-(2-bromophenyl)-2-furancarboximidate
• 2-Furancarboximidic acid, 5-(2-bromophenyl)-, methyl ester

2-Furancarboximidic acid, 5-(2-bromophenyl)-, methyl ester

CAS: 88649-67-6

Formula: C₁₂H₁₀BrNO₂

Molecular weight: 280.1173

Ref: IN-DA004979