CymitQuimica logo

CAS 886493-61-4

:

N-[(4-Hydroxyphenyl)methyl]-N-methylacetamide

Description:
N-[(4-Hydroxyphenyl)methyl]-N-methylacetamide, identified by its CAS number 886493-61-4, is an organic compound characterized by its amide functional group. This substance features a methyl group attached to the nitrogen atom, along with a 4-hydroxyphenylmethyl moiety, which contributes to its potential biological activity. The presence of the hydroxyl group on the phenyl ring enhances its solubility in polar solvents and may influence its interaction with biological targets. The compound is likely to exhibit moderate to high stability under standard conditions, although specific stability data would depend on environmental factors such as temperature and pH. Its molecular structure suggests potential applications in pharmaceuticals or as a biochemical probe, particularly in studies related to enzyme inhibition or receptor binding. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would be essential for practical applications and would typically be determined through experimental methods. Overall, N-[(4-Hydroxyphenyl)methyl]-N-methylacetamide represents a compound of interest in medicinal chemistry and related fields.
Formula:C10H13NO2
InChI:InChI=1S/C10H13NO2/c1-8(12)11(2)7-9-3-5-10(13)6-4-9/h3-6,13H,7H2,1-2H3
InChI key:InChIKey=CMWIMORSIUZXNB-UHFFFAOYSA-N
SMILES:C(N(C(C)=O)C)C1=CC=C(O)C=C1
Synonyms:
  • Acetamide, N-[(4-hydroxyphenyl)methyl]-N-methyl-
  • N-[(4-Hydroxyphenyl)methyl]-N-methylacetamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.