
CAS 886493-67-0
:5,6,7,8-Tetrahydro-6-methyl-2-(methylthio)-4-(2-thienyl)-1,6-naphthyridine-3-carbonitrile
Description:
5,6,7,8-Tetrahydro-6-methyl-2-(methylthio)-4-(2-thienyl)-1,6-naphthyridine-3-carbonitrile is a complex organic compound characterized by its unique bicyclic structure, which includes a naphthyridine core. This compound features a tetrahydro configuration, indicating the presence of a saturated ring system, and incorporates a methylthio group, which enhances its chemical reactivity and potential biological activity. The presence of a thienyl group suggests that it may exhibit interesting electronic properties and interactions due to the sulfur atom in the thiophene ring. Additionally, the carbonitrile functional group contributes to its polarity and potential for hydrogen bonding, which can influence its solubility and reactivity. Such compounds are often studied for their pharmacological properties, including potential applications in medicinal chemistry. The specific arrangement of substituents on the naphthyridine framework can significantly affect the compound's biological activity, making it a subject of interest in drug discovery and development.
Formula:C15H15N3S2
InChI:InChI=1S/C15H15N3S2/c1-18-6-5-12-11(9-18)14(13-4-3-7-20-13)10(8-16)15(17-12)19-2/h3-4,7H,5-6,9H2,1-2H3
InChI key:InChIKey=GYDJSZRKHBERQX-UHFFFAOYSA-N
SMILES:C(#N)C=1C(=C2C(=NC1SC)CCN(C)C2)C3=CC=CS3
Synonyms:- 1,6-Naphthyridine-3-carbonitrile, 5,6,7,8-tetrahydro-6-methyl-2-(methylthio)-4-(2-thienyl)-
- 5,6,7,8-Tetrahydro-6-methyl-2-(methylthio)-4-(2-thienyl)-1,6-naphthyridine-3-carbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.