CAS 886494-06-0

4-Cyclopropyl-5-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione

Description:

4-Cyclopropyl-5-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione is a heterocyclic compound characterized by its triazole ring, which contains nitrogen atoms in its structure. This compound features a cyclopropyl group and an ethyl group, contributing to its unique chemical properties and potential biological activity. The presence of the thione functional group (a sulfur atom double-bonded to a carbon atom) suggests that it may exhibit specific reactivity patterns, such as nucleophilicity or coordination with metal ions. The dihydro form indicates that the compound may have saturated characteristics, which can influence its stability and solubility in various solvents. This compound may be of interest in pharmaceutical research due to its potential applications in drug development, particularly in areas related to antifungal or antibacterial activities. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, 4-Cyclopropyl-5-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione represents a class of compounds that could be valuable in medicinal chemistry.

Formula: C₇H₁₁N₃S

InChI: InChI=1S/C7H11N3S/c1-2-6-8-9-7(11)10(6)5-3-4-5/h5H,2-4H2,1H3,(H,9,11)

InChI key: InChIKey=HIXDKEVUCPHBTH-UHFFFAOYSA-N

SMILES: C(C)C=1N(C(=S)NN1)C2CC2

Synonyms:

• 3H-1,2,4-Triazole-3-thione, 4-cyclopropyl-5-ethyl-2,4-dihydro-
• 4-Cyclopropyl-5-ethyl-2,4-dihydro-3H-1,2,4-triazole-3-thione
• 4-Cyclopropyl-5-ethyl-4H-1,2,4-triazole-3-thiol