CAS 886494-11-7
:2,4-Dihydro-5-(3-methoxyphenyl)-3H-pyrazol-3-one
Description:
2,4-Dihydro-5-(3-methoxyphenyl)-3H-pyrazol-3-one is a chemical compound characterized by its pyrazolone structure, which features a five-membered ring containing two nitrogen atoms. This compound typically exhibits a range of properties, including moderate solubility in organic solvents and potential biological activity, making it of interest in pharmaceutical research. The presence of the methoxyphenyl group enhances its lipophilicity, which can influence its interaction with biological targets. The compound may also display antioxidant or anti-inflammatory properties, although specific biological activities would depend on further empirical studies. Its molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. As with many pyrazolone derivatives, it is essential to consider safety and toxicity profiles when evaluating its use in various applications. Overall, 2,4-Dihydro-5-(3-methoxyphenyl)-3H-pyrazol-3-one represents a versatile scaffold for further chemical modifications and biological evaluations.
Formula:C10H10N2O2
InChI:InChI=1S/C10H10N2O2/c1-14-8-4-2-3-7(5-8)9-6-10(13)12-11-9/h2-5H,6H2,1H3,(H,12,13)
InChI key:InChIKey=MOQBUHRNJINERX-UHFFFAOYSA-N
SMILES:O(C)C=1C=C(C=CC1)C=2CC(=O)NN2
Synonyms:- 3H-Pyrazol-3-one, 2,4-dihydro-5-(3-methoxyphenyl)-
- 2,4-Dihydro-5-(3-methoxyphenyl)-3H-pyrazol-3-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.