CymitQuimica logo

CAS 886494-31-1

:

2-Methyl-3-(4-morpholinyl)benzoic acid hydrazide

Description:
2-Methyl-3-(4-morpholinyl)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a methyl group and a morpholine ring, contributing to its unique properties. The presence of the morpholine moiety suggests potential applications in medicinal chemistry, as morpholines are often associated with biological activity. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and potential interactions with biological targets. This compound may exhibit moderate solubility in polar solvents due to the presence of both hydrophobic (aromatic and aliphatic) and hydrophilic (hydrazide and morpholine) components. Its molecular structure may influence its reactivity, stability, and potential applications in pharmaceuticals or agrochemicals. As with many organic compounds, safety and handling precautions should be observed, particularly in laboratory settings, to mitigate any risks associated with exposure or chemical reactivity. Further studies would be necessary to fully elucidate its properties and potential uses.
Formula:C12H17N3O2
InChI:InChI=1S/C12H17N3O2/c1-9-10(12(16)14-13)3-2-4-11(9)15-5-7-17-8-6-15/h2-4H,5-8,13H2,1H3,(H,14,16)
InChI key:InChIKey=GQCGPDXPTOZCJY-UHFFFAOYSA-N
SMILES:CC1=C(C=CC=C1C(NN)=O)N2CCOCC2
Synonyms:
  • Benzoic acid, 2-methyl-3-(4-morpholinyl)-, hydrazide
  • 2-Methyl-3-(4-morpholinyl)benzoic acid hydrazide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.