CAS 886494-33-3

4-Chloro-3-(4-morpholinyl)benzoic acid hydrazide

Description:

4-Chloro-3-(4-morpholinyl)benzoic acid hydrazide is a chemical compound characterized by its hydrazide functional group, which is derived from benzoic acid. This compound features a chloro substituent at the 4-position and a morpholine ring at the 3-position of the aromatic system, contributing to its unique properties. The presence of the morpholine moiety enhances its solubility and potential biological activity. Typically, compounds like this may exhibit various pharmacological activities, making them of interest in medicinal chemistry. The hydrazide functional group can participate in various chemical reactions, including hydrazone formation and coupling reactions, which are valuable in synthetic organic chemistry. Additionally, the compound's structure suggests potential interactions with biological targets, which could be explored for therapeutic applications. As with many organic compounds, its stability, reactivity, and solubility will depend on the specific conditions under which it is handled. Safety data and handling precautions should be consulted when working with this substance, as with any chemical compound.

Formula: C₁₁H₁₄ClN₃O₂

InChI: InChI=1S/C11H14ClN3O2/c12-9-2-1-8(11(16)14-13)7-10(9)15-3-5-17-6-4-15/h1-2,7H,3-6,13H2,(H,14,16)

InChI key: InChIKey=NPJHEVOSBJDOES-UHFFFAOYSA-N

SMILES: ClC=1C(=CC(C(NN)=O)=CC1)N2CCOCC2

Synonyms:

• Benzoic acid, 4-chloro-3-(4-morpholinyl)-, hydrazide
• 4-Chloro-3-(4-morpholinyl)benzoic acid hydrazide