
CAS 886494-52-6
:1-[5-(2-Amino-4-methoxyphenyl)-2-furanyl]ethanone
Description:
1-[5-(2-Amino-4-methoxyphenyl)-2-furanyl]ethanone, with the CAS number 886494-52-6, is an organic compound characterized by its unique structural features, which include a furan ring and an ethanone moiety. This compound exhibits a molecular structure that incorporates an amino group and a methoxy group, contributing to its potential reactivity and biological activity. The presence of the furan ring suggests that it may participate in various chemical reactions, such as electrophilic substitutions or cycloadditions. Additionally, the amino and methoxy substituents can influence the compound's solubility, polarity, and interaction with biological targets. Such characteristics may render it of interest in medicinal chemistry, particularly in the development of pharmaceuticals. The compound's properties, including melting point, boiling point, and spectral data, would typically be determined through experimental methods, providing insights into its stability and reactivity under different conditions. Overall, this compound represents a fascinating example of a heterocyclic organic molecule with potential applications in various fields of chemistry and pharmacology.
Formula:C13H13NO3
InChI:InChI=1S/C13H13NO3/c1-8(15)12-5-6-13(17-12)10-4-3-9(16-2)7-11(10)14/h3-7H,14H2,1-2H3
InChI key:InChIKey=PERGQGDIUIHTBQ-UHFFFAOYSA-N
SMILES:NC1=C(C=2OC(C(C)=O)=CC2)C=CC(OC)=C1
Synonyms:- 1-[5-(2-Amino-4-methoxyphenyl)-2-furanyl]ethanone
- Ethanone, 1-[5-(2-amino-4-methoxyphenyl)-2-furanyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.